C23H18O5 — CID 174507973
3-O-(2-methylprop-2-enoyl) 1-O-naphthalen-1-yl 2-methylbenzene-1,3-dicarboxylate (PubChem CID 174507973) has the molecular formula C23H18O5 and a molecular weight of 374.39 g/mol. Its IUPAC name is 3-O-(2-methylprop-2-enoyl) 1-O-naphthalen-1-yl 2-methylbenzene-1,3-dicarboxylate.
| Compound Name | 3-O-(2-methylprop-2-enoyl) 1-O-naphthalen-1-yl 2-methylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 174507973 |
| Molecular Formula | C23H18O5 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 3-O-(2-methylprop-2-enoyl) 1-O-naphthalen-1-yl 2-methylbenzene-1,3-dicarboxylate |
| SMILES | C=C(C)C(=O)OC(=O)c1cccc(C(=O)Oc2cccc3ccccc23)c1C |
| InChI | InChI=1S/C23H18O5/c1-14(2)21(24)28-23(26)18-12-7-11-17(15(18)3)22(25)27-20-13-6-9-16-8-4-5-10-19(16)20/h4-13H,1H2,2-3H3 |
| InChIKey | KOXKSXLYYTVRRP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|