C13H26O9S — CID 174509810
(3S,4S,5S,6R)-2-heptoxy-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-3-sulfonic acid (PubChem CID 174509810) has the molecular formula C13H26O9S and a molecular weight of 358.41 g/mol. Its IUPAC name is (3S,4S,5S,6R)-2-heptoxy-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-3-sulfonic acid.
| Compound Name | (3S,4S,5S,6R)-2-heptoxy-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-3-sulfonic acid |
|---|---|
| PubChem CID | 174509810 |
| Molecular Formula | C13H26O9S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (3S,4S,5S,6R)-2-heptoxy-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-3-sulfonic acid |
| SMILES | CCCCCCCOC1O[C@H](CO)[C@@H](O)[C@H](O)[C@]1(O)S(=O)(=O)O |
| InChI | InChI=1S/C13H26O9S/c1-2-3-4-5-6-7-21-12-13(17,23(18,19)20)11(16)10(15)9(8-14)22-12/h9-12,14-17H,2-8H2,1H3,(H,18,19,20)/t9-,10-,11+,12?,13+/m1/s1 |
| InChIKey | UIEQAUZALHMCHO-VKYHIEHISA-N |
| XLogP | -1.01 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|