C20H19Cl2FN4OS — CID 174510904
3-[4-chloro-3-(5-chlorothiophen-2-yl)pyrazol-1-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanal (PubChem CID 174510904) has the molecular formula C20H19Cl2FN4OS and a molecular weight of 453.37 g/mol. Its IUPAC name is 3-[4-chloro-3-(5-chlorothiophen-2-yl)pyrazol-1-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanal.
| Compound Name | 3-[4-chloro-3-(5-chlorothiophen-2-yl)pyrazol-1-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanal |
|---|---|
| PubChem CID | 174510904 |
| Molecular Formula | C20H19Cl2FN4OS |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 3-[4-chloro-3-(5-chlorothiophen-2-yl)pyrazol-1-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanal |
| SMILES | O=CC(Cn1cc(Cl)c(-c2ccc(Cl)s2)n1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H19Cl2FN4OS/c21-17-12-27(24-20(17)18-5-6-19(22)29-18)11-16(13-28)26-9-7-25(8-10-26)15-3-1-14(23)2-4-15/h1-6,12-13,16H,7-11H2 |
| InChIKey | YIIUZQWMHRSNAG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|