C23H21ClF4N4O — CID 174510919
3-[4-chloro-5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanal (PubChem CID 174510919) has the molecular formula C23H21ClF4N4O and a molecular weight of 480.89 g/mol. Its IUPAC name is 3-[4-chloro-5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanal.
| Compound Name | 3-[4-chloro-5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanal |
|---|---|
| PubChem CID | 174510919 |
| Molecular Formula | C23H21ClF4N4O |
| Molecular Weight | 480.89 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 3-[4-chloro-5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanal |
| SMILES | O=CC(Cn1nc(C(F)(F)F)c(Cl)c1-c1ccccc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H21ClF4N4O/c24-20-21(16-4-2-1-3-5-16)32(29-22(20)23(26,27)28)14-19(15-33)31-12-10-30(11-13-31)18-8-6-17(25)7-9-18/h1-9,15,19H,10-14H2 |
| InChIKey | JJKFJPHMXQWYKP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|