propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate

C20H19ClN2O3 — CID 174510963

IUPACpropan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate
SMILESCC(C)OC(=O)Cc1nc2cc(Cl)ccc2c(=O)n1Cc1ccccc1
InChIInChI=1S/C20H19ClN2O3/c1-13(2)26-19(24)11-18-22-17-10-15(21)8-9-16(17)20(25)23(18)12-14-6-4-3-5-7-14/h3-10,13H,11-12H2,1-2H3
InChIKeyMZQOOSSVVIOSNN-UHFFFAOYSA-N
MW370.84 g/mol
LogP3.59
Rot. Bonds5

About propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate

propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate (PubChem CID 174510963) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate.

Molecular Properties

Compound Namepropan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate
PubChem CID174510963
Molecular FormulaC20H19ClN2O3
Molecular Weight370.84 g/mol
Exact Mass370.11
IUPAC Namepropan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate
SMILESCC(C)OC(=O)Cc1nc2cc(Cl)ccc2c(=O)n1Cc1ccccc1
InChIInChI=1S/C20H19ClN2O3/c1-13(2)26-19(24)11-18-22-17-10-15(21)8-9-16(17)20(25)23(18)12-14-6-4-3-5-7-14/h3-10,13H,11-12H2,1-2H3
InChIKeyMZQOOSSVVIOSNN-UHFFFAOYSA-N
XLogP3.59
TPSA61.19 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500370.84
LogP ≤ 53.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate?
The IUPAC name of propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate (CID 174510963) is propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate.
What is the SMILES notation for propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate?
The canonical SMILES for propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate is CC(C)OC(=O)Cc1nc2cc(Cl)ccc2c(=O)n1Cc1ccccc1.
What is the InChIKey of propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate?
The InChIKey is MZQOOSSVVIOSNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN2O3/c1-13(2)26-19(24)11-18-22-17-10-15(21)8-9-16(17)20(25)23(18)12-14-6-4-3-5-7-14/h3-10,13H,11-12H2,1-2H3.
What are the key properties of propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate?
propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate has a molecular weight of 370.84 g/mol, XLogP of 3.59, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(3-benzyl-7-chloro-4-oxoquinazolin-2-yl)acetate is sourced from PubChem (CID 174510963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).