C37H29N3O — CID 174511768
[1-(1H-azepin-2-yl)-1,2,3,6-tetrahydrochrysen-3-yl]-(4-phenyldiazenylphenyl)methanone (PubChem CID 174511768) has the molecular formula C37H29N3O and a molecular weight of 531.66 g/mol. Its IUPAC name is [1-(1H-azepin-2-yl)-1,2,3,6-tetrahydrochrysen-3-yl]-(4-phenyldiazenylphenyl)methanone.
| Compound Name | [1-(1H-azepin-2-yl)-1,2,3,6-tetrahydrochrysen-3-yl]-(4-phenyldiazenylphenyl)methanone |
|---|---|
| PubChem CID | 174511768 |
| Molecular Formula | C37H29N3O |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | [1-(1H-azepin-2-yl)-1,2,3,6-tetrahydrochrysen-3-yl]-(4-phenyldiazenylphenyl)methanone |
| SMILES | O=C(c1ccc(/N=N/c2ccccc2)cc1)C1C=c2c(ccc3c2=CCc2ccccc2-3)C(C2=CC=CC=CN2)C1 |
| InChI | InChI=1S/C37H29N3O/c41-37(26-14-17-29(18-15-26)40-39-28-10-3-1-4-11-28)27-23-34-32-19-16-25-9-6-7-12-30(25)31(32)20-21-33(34)35(24-27)36-13-5-2-8-22-38-36/h1-15,17-23,27,35,38H,16,24H2/b40-39+ |
| InChIKey | GIUFWTBUHKPYOE-XQQUEIPISA-N |
| XLogP | 7.43 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|