C36H31FN2O2 — CID 174512130
[1-(1H-azepin-2-yl)-5-(5-ethyl-4,5-dihydro-1,3-oxazol-2-yl)-1,2,3,6-tetrahydrochrysen-3-yl]-(4-fluorophenyl)methanone (PubChem CID 174512130) has the molecular formula C36H31FN2O2 and a molecular weight of 542.65 g/mol. Its IUPAC name is [1-(1H-azepin-2-yl)-5-(5-ethyl-4,5-dihydro-1,3-oxazol-2-yl)-1,2,3,6-tetrahydrochrysen-3-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-(1H-azepin-2-yl)-5-(5-ethyl-4,5-dihydro-1,3-oxazol-2-yl)-1,2,3,6-tetrahydrochrysen-3-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 174512130 |
| Molecular Formula | C36H31FN2O2 |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | [1-(1H-azepin-2-yl)-5-(5-ethyl-4,5-dihydro-1,3-oxazol-2-yl)-1,2,3,6-tetrahydrochrysen-3-yl]-(4-fluorophenyl)methanone |
| SMILES | CCC1CN=C(C2=c3c(ccc4c3=CC(C(=O)c3ccc(F)cc3)CC4C3=CC=CC=CN3)-c3ccccc3C2)O1 |
| InChI | InChI=1S/C36H31FN2O2/c1-2-26-21-39-36(41-26)32-18-23-8-5-6-9-27(23)29-16-15-28-30(33-10-4-3-7-17-38-33)19-24(20-31(28)34(29)32)35(40)22-11-13-25(37)14-12-22/h3-17,20,24,26,30,38H,2,18-19,21H2,1H3 |
| InChIKey | MCAIXYATDMZCHU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |