C13H11N3O3S — CID 17451363
N-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)furan-2-carboxamide (PubChem CID 17451363) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is N-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)furan-2-carboxamide.
| Compound Name | N-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17451363 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)furan-2-carboxamide |
| SMILES | CCc1cc2c(=O)n(NC(=O)c3ccco3)cnc2s1 |
| InChI | InChI=1S/C13H11N3O3S/c1-2-8-6-9-12(20-8)14-7-16(13(9)18)15-11(17)10-4-3-5-19-10/h3-7H,2H2,1H3,(H,15,17) |
| InChIKey | MEVSHTDVMGBYDA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |