C20H20N4O2S — CID 8001763
N-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-4-(1H-indol-3-yl)butanamide (PubChem CID 8001763) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 8001763 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-4-(1H-indol-3-yl)butanamide |
| SMILES | CCc1cc2c(=O)n(NC(=O)CCCc3c[nH]c4ccccc34)cnc2s1 |
| InChI | InChI=1S/C20H20N4O2S/c1-2-14-10-16-19(27-14)22-12-24(20(16)26)23-18(25)9-5-6-13-11-21-17-8-4-3-7-15(13)17/h3-4,7-8,10-12,21H,2,5-6,9H2,1H3,(H,23,25) |
| InChIKey | ZAZIRYGHUUCSQC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |