C18H23ClN4 — CID 174514250
2-N-[(3-chlorophenyl)methyl]-3-methyl-6-piperazin-1-ylbenzene-1,2-diamine (PubChem CID 174514250) has the molecular formula C18H23ClN4 and a molecular weight of 330.86 g/mol. Its IUPAC name is 2-N-[(3-chlorophenyl)methyl]-3-methyl-6-piperazin-1-ylbenzene-1,2-diamine.
| Compound Name | 2-N-[(3-chlorophenyl)methyl]-3-methyl-6-piperazin-1-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 174514250 |
| Molecular Formula | C18H23ClN4 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-N-[(3-chlorophenyl)methyl]-3-methyl-6-piperazin-1-ylbenzene-1,2-diamine |
| SMILES | Cc1ccc(N2CCNCC2)c(N)c1NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H23ClN4/c1-13-5-6-16(23-9-7-21-8-10-23)17(20)18(13)22-12-14-3-2-4-15(19)11-14/h2-6,11,21-22H,7-10,12,20H2,1H3 |
| InChIKey | UUUGCTKSSHCJHK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|