C13H20N4O — CID 174515123
4-[3-(dimethylamino)butanimidoyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 174515123) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-[3-(dimethylamino)butanimidoyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[3-(dimethylamino)butanimidoyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 174515123 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 4-[3-(dimethylamino)butanimidoyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | [H]/N=C(\CC(C)N(C)C)c1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C13H20N4O/c1-9(17(2)3)8-12(14)10-4-6-11(7-5-10)13(15)16-18/h4-7,9,14,18H,8H2,1-3H3,(H2,15,16)/b14-12+ |
| InChIKey | ZVLQATFZXDJNIZ-WYMLVPIESA-N |
| XLogP | 1.49 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|