C12H23N3O4 — CID 174515371
6-amino-2-imino-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 174515371) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 6-amino-2-imino-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 6-amino-2-imino-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 174515371 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 6-amino-2-imino-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | [H]/N=C(/CC(C)(CCN)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H23N3O4/c1-11(2,3)19-10(18)15-12(4,5-6-13)7-8(14)9(16)17/h14H,5-7,13H2,1-4H3,(H,15,18)(H,16,17)/b14-8- |
| InChIKey | GYSZFZXUMSHCMH-ZSOIEALJSA-N |
| XLogP | 1.11 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|