C19H19N3O3 — CID 174518362
N-[2,4-dimethoxy-3-(4-methoxyphenyl)phenyl]pyrimidin-2-amine (PubChem CID 174518362) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[2,4-dimethoxy-3-(4-methoxyphenyl)phenyl]pyrimidin-2-amine.
| Compound Name | N-[2,4-dimethoxy-3-(4-methoxyphenyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 174518362 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[2,4-dimethoxy-3-(4-methoxyphenyl)phenyl]pyrimidin-2-amine |
| SMILES | COc1ccc(-c2c(OC)ccc(Nc3ncccn3)c2OC)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-23-14-7-5-13(6-8-14)17-16(24-2)10-9-15(18(17)25-3)22-19-20-11-4-12-21-19/h4-12H,1-3H3,(H,20,21,22) |
| InChIKey | IAFMICPPHJIUGS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |