C20H21N3O2S — CID 68886927
N-[4-(2,3-dimethoxyphenyl)-2-ethylsulfanylphenyl]pyrimidin-2-amine (PubChem CID 68886927) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[4-(2,3-dimethoxyphenyl)-2-ethylsulfanylphenyl]pyrimidin-2-amine.
| Compound Name | N-[4-(2,3-dimethoxyphenyl)-2-ethylsulfanylphenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68886927 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[4-(2,3-dimethoxyphenyl)-2-ethylsulfanylphenyl]pyrimidin-2-amine |
| SMILES | CCSc1cc(-c2cccc(OC)c2OC)ccc1Nc1ncccn1 |
| InChI | InChI=1S/C20H21N3O2S/c1-4-26-18-13-14(15-7-5-8-17(24-2)19(15)25-3)9-10-16(18)23-20-21-11-6-12-22-20/h5-13H,4H2,1-3H3,(H,21,22,23) |
| InChIKey | LRIRFHTUDYKCIR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |