C20H27BrO2 — CID 174519513
7-(6-bromo-3-methylhexyl)-1-(2-methoxyethoxy)naphthalene (PubChem CID 174519513) has the molecular formula C20H27BrO2 and a molecular weight of 379.34 g/mol. Its IUPAC name is 7-(6-bromo-3-methylhexyl)-1-(2-methoxyethoxy)naphthalene.
| Compound Name | 7-(6-bromo-3-methylhexyl)-1-(2-methoxyethoxy)naphthalene |
|---|---|
| PubChem CID | 174519513 |
| Molecular Formula | C20H27BrO2 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 7-(6-bromo-3-methylhexyl)-1-(2-methoxyethoxy)naphthalene |
| SMILES | COCCOc1cccc2ccc(CCC(C)CCCBr)cc12 |
| InChI | InChI=1S/C20H27BrO2/c1-16(5-4-12-21)8-9-17-10-11-18-6-3-7-20(19(18)15-17)23-14-13-22-2/h3,6-7,10-11,15-16H,4-5,8-9,12-14H2,1-2H3 |
| InChIKey | NLTXTVKVJNSIPR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|