C6H10N4O4S — CID 174520020
[(5-methoxycarbonyl-2H-triazol-4-yl)-methylamino]methanesulfinic acid (PubChem CID 174520020) has the molecular formula C6H10N4O4S and a molecular weight of 234.24 g/mol. Its IUPAC name is [(5-methoxycarbonyl-2H-triazol-4-yl)-methylamino]methanesulfinic acid.
| Compound Name | [(5-methoxycarbonyl-2H-triazol-4-yl)-methylamino]methanesulfinic acid |
|---|---|
| PubChem CID | 174520020 |
| Molecular Formula | C6H10N4O4S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | [(5-methoxycarbonyl-2H-triazol-4-yl)-methylamino]methanesulfinic acid |
| SMILES | COC(=O)c1n[nH]nc1N(C)CS(=O)O |
| InChI | InChI=1S/C6H10N4O4S/c1-10(3-15(12)13)5-4(6(11)14-2)7-9-8-5/h3H2,1-2H3,(H,12,13)(H,7,8,9) |
| InChIKey | MXUNCEXMMILFJG-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|