C6H10N4O4S — CID 67215267
methyl 5-[methyl(methylsulfonyl)amino]-2H-triazole-4-carboxylate (PubChem CID 67215267) has the molecular formula C6H10N4O4S and a molecular weight of 234.24 g/mol. Its IUPAC name is methyl 5-[methyl(methylsulfonyl)amino]-2H-triazole-4-carboxylate.
| Compound Name | methyl 5-[methyl(methylsulfonyl)amino]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 67215267 |
| Molecular Formula | C6H10N4O4S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | methyl 5-[methyl(methylsulfonyl)amino]-2H-triazole-4-carboxylate |
| SMILES | COC(=O)c1n[nH]nc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C6H10N4O4S/c1-10(15(3,12)13)5-4(6(11)14-2)7-9-8-5/h1-3H3,(H,7,8,9) |
| InChIKey | FSXPUMQUQANYDA-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |