methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate

C5H4BrClN2O4S — CID 165462973

IUPACmethyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate
SMILESCOC(=O)c1n[nH]c(S(=O)(=O)Cl)c1Br
InChIInChI=1S/C5H4BrClN2O4S/c1-13-5(10)3-2(6)4(9-8-3)14(7,11)12/h1H3,(H,8,9)
InChIKeyUPBCWNPOXZXPOM-UHFFFAOYSA-N
MW303.52 g/mol
LogP0.89
Rot. Bonds2

About methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate

methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate (PubChem CID 165462973) has the molecular formula C5H4BrClN2O4S and a molecular weight of 303.52 g/mol. Its IUPAC name is methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate
PubChem CID165462973
Molecular FormulaC5H4BrClN2O4S
Molecular Weight303.52 g/mol
Exact Mass301.88
IUPAC Namemethyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate
SMILESCOC(=O)c1n[nH]c(S(=O)(=O)Cl)c1Br
InChIInChI=1S/C5H4BrClN2O4S/c1-13-5(10)3-2(6)4(9-8-3)14(7,11)12/h1H3,(H,8,9)
InChIKeyUPBCWNPOXZXPOM-UHFFFAOYSA-N
XLogP0.89
TPSA89.12 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.52
LogP ≤ 50.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate?
The IUPAC name of methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate (CID 165462973) is methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate.
What is the SMILES notation for methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate?
The canonical SMILES for methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate is COC(=O)c1n[nH]c(S(=O)(=O)Cl)c1Br.
What is the InChIKey of methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate?
The InChIKey is UPBCWNPOXZXPOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrClN2O4S/c1-13-5(10)3-2(6)4(9-8-3)14(7,11)12/h1H3,(H,8,9).
What are the key properties of methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate?
methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate has a molecular weight of 303.52 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-5-chlorosulfonyl-1H-pyrazole-3-carboxylate is sourced from PubChem (CID 165462973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).