C5H5ClN2O4S — CID 18363150
methyl 5-chlorosulfonyl-1H-pyrazole-4-carboxylate (PubChem CID 18363150) has the molecular formula C5H5ClN2O4S and a molecular weight of 224.62 g/mol. Its IUPAC name is methyl 5-chlorosulfonyl-1H-pyrazole-4-carboxylate.
| Compound Name | methyl 5-chlorosulfonyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 18363150 |
| Molecular Formula | C5H5ClN2O4S |
| Molecular Weight | 224.62 g/mol |
| Exact Mass | 223.97 |
| IUPAC Name | methyl 5-chlorosulfonyl-1H-pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cn[nH]c1S(=O)(=O)Cl |
| InChI | InChI=1S/C5H5ClN2O4S/c1-12-5(9)3-2-7-8-4(3)13(6,10)11/h2H,1H3,(H,7,8) |
| InChIKey | JUPRTCJWTVXBNZ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.62 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |