C24H32N4O5S2 — CID 174521245
tert-butyl 3-[1-[3-(carbamoylamino)-5-phenylthiophen-2-yl]prop-2-enylsulfonylamino]piperidine-1-carboxylate (PubChem CID 174521245) has the molecular formula C24H32N4O5S2 and a molecular weight of 520.68 g/mol. Its IUPAC name is tert-butyl 3-[1-[3-(carbamoylamino)-5-phenylthiophen-2-yl]prop-2-enylsulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-[3-(carbamoylamino)-5-phenylthiophen-2-yl]prop-2-enylsulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174521245 |
| Molecular Formula | C24H32N4O5S2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | tert-butyl 3-[1-[3-(carbamoylamino)-5-phenylthiophen-2-yl]prop-2-enylsulfonylamino]piperidine-1-carboxylate |
| SMILES | C=CC(c1sc(-c2ccccc2)cc1NC(N)=O)S(=O)(=O)NC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H32N4O5S2/c1-5-20(21-18(26-22(25)29)14-19(34-21)16-10-7-6-8-11-16)35(31,32)27-17-12-9-13-28(15-17)23(30)33-24(2,3)4/h5-8,10-11,14,17,20,27H,1,9,12-13,15H2,2-4H3,(H3,25,26,29) |
| InChIKey | XRBBWDDAJPDRDS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|