About potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate
potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate (PubChem CID 174521265) has the molecular formula C24H48KNO5
and a molecular weight of 469.75 g/mol. Its IUPAC name is potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate |
| PubChem CID | 174521265 |
| Molecular Formula | C24H48KNO5 |
| Molecular Weight | 469.75 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)[O-].OCCN(CCO)CCO.[K+] |
| InChI | InChI=1S/C18H34O2.C6H15NO3.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;8-4-1-7(2-5-9)3-6-10;/h9-10H,2-8,11-17H2,1H3,(H,19,20);8-10H,1-6H2;/q;;+1/p-1/b10-9-;; |
| InChIKey | WDFKWLHMGRICTF-XXAVUKJNSA-M |
| XLogP | 0.04 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.75 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate?
The IUPAC name of potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate (CID 174521265) is potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate.
What is the SMILES notation for potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate?
The canonical SMILES for potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)[O-].OCCN(CCO)CCO.[K+].
What is the InChIKey of potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate?
The InChIKey is WDFKWLHMGRICTF-XXAVUKJNSA-M. The full InChI is InChI=1S/C18H34O2.C6H15NO3.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;8-4-1-7(2-5-9)3-6-10;/h9-10H,2-8,11-17H2,1H3,(H,19,20);8-10H,1-6H2;/q;;+1/p-1/b10-9-;;.
What are the key properties of potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate?
potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate has a molecular weight of 469.75 g/mol, XLogP of 0.04, 21 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-[bis(2-hydroxyethyl)amino]ethanol;(Z)-octadec-9-enoate is sourced from PubChem (CID 174521265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).