C12H23N3O4 — CID 174521285
[carbamoyl(piperidin-4-yloxymethyl)amino] 2,2-dimethylpropanoate (PubChem CID 174521285) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is [carbamoyl(piperidin-4-yloxymethyl)amino] 2,2-dimethylpropanoate.
| Compound Name | [carbamoyl(piperidin-4-yloxymethyl)amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174521285 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [carbamoyl(piperidin-4-yloxymethyl)amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON(COC1CCNCC1)C(N)=O |
| InChI | InChI=1S/C12H23N3O4/c1-12(2,3)10(16)19-15(11(13)17)8-18-9-4-6-14-7-5-9/h9,14H,4-8H2,1-3H3,(H2,13,17) |
| InChIKey | LSNJBNAOMPGZFE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|