About (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate
(3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate (PubChem CID 174522146) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate.
Molecular Properties
| Compound Name | (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate |
| PubChem CID | 174522146 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate |
| SMILES | CCOc1cccc(OC(=O)C(C)N=C(N)N)c1 |
| InChI | InChI=1S/C12H17N3O3/c1-3-17-9-5-4-6-10(7-9)18-11(16)8(2)15-12(13)14/h4-8H,3H2,1-2H3,(H4,13,14,15) |
| InChIKey | XQHIBIJZEUCHLQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate?
The IUPAC name of (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate (CID 174522146) is (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate.
What is the SMILES notation for (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate?
The canonical SMILES for (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate is CCOc1cccc(OC(=O)C(C)N=C(N)N)c1.
What is the InChIKey of (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate?
The InChIKey is XQHIBIJZEUCHLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-3-17-9-5-4-6-10(7-9)18-11(16)8(2)15-12(13)14/h4-8H,3H2,1-2H3,(H4,13,14,15).
What are the key properties of (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate?
(3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate has a molecular weight of 251.29 g/mol, XLogP of 0.65, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxyphenyl) 2-(diaminomethylideneamino)propanoate is sourced from PubChem (CID 174522146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).