About 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide
2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide (PubChem CID 55060557) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide |
| PubChem CID | 55060557 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide |
| SMILES | CCOc1cccc(OC(CC)/C(N)=N/O)c1 |
| InChI | InChI=1S/C12H18N2O3/c1-3-11(12(13)14-15)17-10-7-5-6-9(8-10)16-4-2/h5-8,11,15H,3-4H2,1-2H3,(H2,13,14) |
| InChIKey | RBAGDHOPYSDOKP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide?
The IUPAC name of 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide (CID 55060557) is 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide.
What is the SMILES notation for 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide?
The canonical SMILES for 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide is CCOc1cccc(OC(CC)/C(N)=N/O)c1.
What is the InChIKey of 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide?
The InChIKey is RBAGDHOPYSDOKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-3-11(12(13)14-15)17-10-7-5-6-9(8-10)16-4-2/h5-8,11,15H,3-4H2,1-2H3,(H2,13,14).
What are the key properties of 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide?
2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide has a molecular weight of 238.29 g/mol, XLogP of 1.99, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethoxyphenoxy)-N'-hydroxybutanimidamide is sourced from PubChem (CID 55060557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).