About 2-(3-bromophenoxy)-N'-hydroxybutanimidamide
2-(3-bromophenoxy)-N'-hydroxybutanimidamide (PubChem CID 76915609) has the molecular formula C10H13BrN2O2
and a molecular weight of 273.13 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 2-(3-bromophenoxy)-N'-hydroxybutanimidamide |
| PubChem CID | 76915609 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-(3-bromophenoxy)-N'-hydroxybutanimidamide |
| SMILES | CCC(Oc1cccc(Br)c1)C(N)=NO |
| InChI | InChI=1S/C10H13BrN2O2/c1-2-9(10(12)13-14)15-8-5-3-4-7(11)6-8/h3-6,9,14H,2H2,1H3,(H2,12,13) |
| InChIKey | ZTAVQCVLTPFNEQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromophenoxy)-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenoxy)-N'-hydroxybutanimidamide?
The IUPAC name of 2-(3-bromophenoxy)-N'-hydroxybutanimidamide (CID 76915609) is 2-(3-bromophenoxy)-N'-hydroxybutanimidamide.
What is the SMILES notation for 2-(3-bromophenoxy)-N'-hydroxybutanimidamide?
The canonical SMILES for 2-(3-bromophenoxy)-N'-hydroxybutanimidamide is CCC(Oc1cccc(Br)c1)C(N)=NO.
What is the InChIKey of 2-(3-bromophenoxy)-N'-hydroxybutanimidamide?
The InChIKey is ZTAVQCVLTPFNEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O2/c1-2-9(10(12)13-14)15-8-5-3-4-7(11)6-8/h3-6,9,14H,2H2,1H3,(H2,12,13).
What are the key properties of 2-(3-bromophenoxy)-N'-hydroxybutanimidamide?
2-(3-bromophenoxy)-N'-hydroxybutanimidamide has a molecular weight of 273.13 g/mol, XLogP of 2.35, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenoxy)-N'-hydroxybutanimidamide is sourced from PubChem (CID 76915609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).