About (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide
(2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide (PubChem CID 123956670) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide.
Molecular Properties
| Compound Name | (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide |
| PubChem CID | 123956670 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide |
| SMILES | CC[C@H](Oc1ccc(OC)cc1)C(N)=NO |
| InChI | InChI=1S/C11H16N2O3/c1-3-10(11(12)13-14)16-9-6-4-8(15-2)5-7-9/h4-7,10,14H,3H2,1-2H3,(H2,12,13)/t10-/m0/s1 |
| InChIKey | QRKRNJHBPKKPJH-JTQLQIEISA-N |
| XLogP | 1.60 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide?
The IUPAC name of (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide (CID 123956670) is (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide.
What is the SMILES notation for (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide?
The canonical SMILES for (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide is CC[C@H](Oc1ccc(OC)cc1)C(N)=NO.
What is the InChIKey of (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide?
The InChIKey is QRKRNJHBPKKPJH-JTQLQIEISA-N. The full InChI is InChI=1S/C11H16N2O3/c1-3-10(11(12)13-14)16-9-6-4-8(15-2)5-7-9/h4-7,10,14H,3H2,1-2H3,(H2,12,13)/t10-/m0/s1.
What are the key properties of (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide?
(2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide has a molecular weight of 224.26 g/mol, XLogP of 1.60, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N'-hydroxy-2-(4-methoxyphenoxy)butanimidamide is sourced from PubChem (CID 123956670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).