C10H12ClFN2O2 — CID 76915922
2-(2-chloro-4-fluorophenoxy)-N'-hydroxybutanimidamide (PubChem CID 76915922) has the molecular formula C10H12ClFN2O2 and a molecular weight of 246.67 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N'-hydroxybutanimidamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 76915922 |
| Molecular Formula | C10H12ClFN2O2 |
| Molecular Weight | 246.67 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N'-hydroxybutanimidamide |
| SMILES | CCC(Oc1ccc(F)cc1Cl)C(N)=NO |
| InChI | InChI=1S/C10H12ClFN2O2/c1-2-8(10(13)14-15)16-9-4-3-6(12)5-7(9)11/h3-5,8,15H,2H2,1H3,(H2,13,14) |
| InChIKey | ZGAWUXSVFJYSLP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.67 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|