About (4-methoxyphenyl) N'-hydroxycarbamimidate
(4-methoxyphenyl) N'-hydroxycarbamimidate (PubChem CID 71376980) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is (4-methoxyphenyl) N'-hydroxycarbamimidate.
Molecular Properties
| Compound Name | (4-methoxyphenyl) N'-hydroxycarbamimidate |
| PubChem CID | 71376980 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (4-methoxyphenyl) N'-hydroxycarbamimidate |
| SMILES | COc1ccc(OC(N)=NO)cc1 |
| InChI | InChI=1S/C8H10N2O3/c1-12-6-2-4-7(5-3-6)13-8(9)10-11/h2-5,11H,1H3,(H2,9,10) |
| InChIKey | QMWKBVBJLBDXPK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) N'-hydroxycarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) N'-hydroxycarbamimidate?
The IUPAC name of (4-methoxyphenyl) N'-hydroxycarbamimidate (CID 71376980) is (4-methoxyphenyl) N'-hydroxycarbamimidate.
What is the SMILES notation for (4-methoxyphenyl) N'-hydroxycarbamimidate?
The canonical SMILES for (4-methoxyphenyl) N'-hydroxycarbamimidate is COc1ccc(OC(N)=NO)cc1.
What is the InChIKey of (4-methoxyphenyl) N'-hydroxycarbamimidate?
The InChIKey is QMWKBVBJLBDXPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-12-6-2-4-7(5-3-6)13-8(9)10-11/h2-5,11H,1H3,(H2,9,10).
What are the key properties of (4-methoxyphenyl) N'-hydroxycarbamimidate?
(4-methoxyphenyl) N'-hydroxycarbamimidate has a molecular weight of 182.18 g/mol, XLogP of 0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) N'-hydroxycarbamimidate is sourced from PubChem (CID 71376980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).