C23H24N2O4 — CID 87537496
N'-hydroxy-2,2,2-tris(4-methoxyphenyl)ethanimidamide (PubChem CID 87537496) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is N'-hydroxy-2,2,2-tris(4-methoxyphenyl)ethanimidamide.
| Compound Name | N'-hydroxy-2,2,2-tris(4-methoxyphenyl)ethanimidamide |
|---|---|
| PubChem CID | 87537496 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N'-hydroxy-2,2,2-tris(4-methoxyphenyl)ethanimidamide |
| SMILES | COc1ccc(C(/C(N)=N/O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-27-19-10-4-16(5-11-19)23(22(24)25-26,17-6-12-20(28-2)13-7-17)18-8-14-21(29-3)15-9-18/h4-15,26H,1-3H3,(H2,24,25) |
| InChIKey | VKRQITICEFSSSF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|