C24H32ClN3O — CID 174522507
N-[4-[4-(aminomethyl)phenyl]-1-benzylpiperidin-4-yl]-5-chloropentanamide (PubChem CID 174522507) has the molecular formula C24H32ClN3O and a molecular weight of 413.99 g/mol. Its IUPAC name is N-[4-[4-(aminomethyl)phenyl]-1-benzylpiperidin-4-yl]-5-chloropentanamide.
| Compound Name | N-[4-[4-(aminomethyl)phenyl]-1-benzylpiperidin-4-yl]-5-chloropentanamide |
|---|---|
| PubChem CID | 174522507 |
| Molecular Formula | C24H32ClN3O |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-[4-[4-(aminomethyl)phenyl]-1-benzylpiperidin-4-yl]-5-chloropentanamide |
| SMILES | NCc1ccc(C2(NC(=O)CCCCCl)CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H32ClN3O/c25-15-5-4-8-23(29)27-24(22-11-9-20(18-26)10-12-22)13-16-28(17-14-24)19-21-6-2-1-3-7-21/h1-3,6-7,9-12H,4-5,8,13-19,26H2,(H,27,29) |
| InChIKey | VZKWUSYLSIQDLZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|