About 3-thiophen-3-ylpropyl hydrogen sulfite
3-thiophen-3-ylpropyl hydrogen sulfite (PubChem CID 174522785) has the molecular formula C7H10O3S2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-thiophen-3-ylpropyl hydrogen sulfite.
Molecular Properties
| Compound Name | 3-thiophen-3-ylpropyl hydrogen sulfite |
| PubChem CID | 174522785 |
| Molecular Formula | C7H10O3S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 3-thiophen-3-ylpropyl hydrogen sulfite |
| SMILES | O=S(O)OCCCc1ccsc1 |
| InChI | InChI=1S/C7H10O3S2/c8-12(9)10-4-1-2-7-3-5-11-6-7/h3,5-6H,1-2,4H2,(H,8,9) |
| InChIKey | AEAXMFVHLSSJMZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-thiophen-3-ylpropyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-3-ylpropyl hydrogen sulfite?
The IUPAC name of 3-thiophen-3-ylpropyl hydrogen sulfite (CID 174522785) is 3-thiophen-3-ylpropyl hydrogen sulfite.
What is the SMILES notation for 3-thiophen-3-ylpropyl hydrogen sulfite?
The canonical SMILES for 3-thiophen-3-ylpropyl hydrogen sulfite is O=S(O)OCCCc1ccsc1.
What is the InChIKey of 3-thiophen-3-ylpropyl hydrogen sulfite?
The InChIKey is AEAXMFVHLSSJMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3S2/c8-12(9)10-4-1-2-7-3-5-11-6-7/h3,5-6H,1-2,4H2,(H,8,9).
What are the key properties of 3-thiophen-3-ylpropyl hydrogen sulfite?
3-thiophen-3-ylpropyl hydrogen sulfite has a molecular weight of 206.29 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-3-ylpropyl hydrogen sulfite is sourced from PubChem (CID 174522785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).