C18H18N2O — CID 174523287
4-(3-cyclopentyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol (PubChem CID 174523287) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-(3-cyclopentyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol.
| Compound Name | 4-(3-cyclopentyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol |
|---|---|
| PubChem CID | 174523287 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-(3-cyclopentyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol |
| SMILES | Oc1ccc(-c2cnc3[nH]cc(C4CCCC4)c3c2)cc1 |
| InChI | InChI=1S/C18H18N2O/c21-15-7-5-12(6-8-15)14-9-16-17(13-3-1-2-4-13)11-20-18(16)19-10-14/h5-11,13,21H,1-4H2,(H,19,20) |
| InChIKey | HXDCFKXIVQRWEH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |