C19H23NO2 — CID 174524217
6-ethyl-2-(3-methoxyphenyl)-6-methyl-7,8-dihydro-5H-quinolin-5-ol (PubChem CID 174524217) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 6-ethyl-2-(3-methoxyphenyl)-6-methyl-7,8-dihydro-5H-quinolin-5-ol.
| Compound Name | 6-ethyl-2-(3-methoxyphenyl)-6-methyl-7,8-dihydro-5H-quinolin-5-ol |
|---|---|
| PubChem CID | 174524217 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 6-ethyl-2-(3-methoxyphenyl)-6-methyl-7,8-dihydro-5H-quinolin-5-ol |
| SMILES | CCC1(C)CCc2nc(-c3cccc(OC)c3)ccc2C1O |
| InChI | InChI=1S/C19H23NO2/c1-4-19(2)11-10-17-15(18(19)21)8-9-16(20-17)13-6-5-7-14(12-13)22-3/h5-9,12,18,21H,4,10-11H2,1-3H3 |
| InChIKey | MEXZCHZBWANRKY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |