C13H15NO3 — CID 105492498
[5-ethyl-4-(3-methoxyphenyl)-1,3-oxazol-2-yl]methanol (PubChem CID 105492498) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is [5-ethyl-4-(3-methoxyphenyl)-1,3-oxazol-2-yl]methanol.
| Compound Name | [5-ethyl-4-(3-methoxyphenyl)-1,3-oxazol-2-yl]methanol |
|---|---|
| PubChem CID | 105492498 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | [5-ethyl-4-(3-methoxyphenyl)-1,3-oxazol-2-yl]methanol |
| SMILES | CCc1oc(CO)nc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C13H15NO3/c1-3-11-13(14-12(8-15)17-11)9-5-4-6-10(7-9)16-2/h4-7,15H,3,8H2,1-2H3 |
| InChIKey | FLBQIAXYOWHALR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |