C20H25F3N2O4 — CID 174524491
[(2R)-6-(1-hydroxycyclohexyl)-4-imino-5-oxo-6-[3-(trifluoromethyl)phenyl]hexan-2-yl] carbamate (PubChem CID 174524491) has the molecular formula C20H25F3N2O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is [(2R)-6-(1-hydroxycyclohexyl)-4-imino-5-oxo-6-[3-(trifluoromethyl)phenyl]hexan-2-yl] carbamate.
| Compound Name | [(2R)-6-(1-hydroxycyclohexyl)-4-imino-5-oxo-6-[3-(trifluoromethyl)phenyl]hexan-2-yl] carbamate |
|---|---|
| PubChem CID | 174524491 |
| Molecular Formula | C20H25F3N2O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [(2R)-6-(1-hydroxycyclohexyl)-4-imino-5-oxo-6-[3-(trifluoromethyl)phenyl]hexan-2-yl] carbamate |
| SMILES | [H]/N=C(\C[C@@H](C)OC(N)=O)C(=O)C(c1cccc(C(F)(F)F)c1)C1(O)CCCCC1 |
| InChI | InChI=1S/C20H25F3N2O4/c1-12(29-18(25)27)10-15(24)17(26)16(19(28)8-3-2-4-9-19)13-6-5-7-14(11-13)20(21,22)23/h5-7,11-12,16,24,28H,2-4,8-10H2,1H3,(H2,25,27)/b24-15+/t12-,16?/m1/s1 |
| InChIKey | HVVMFVOZZKVLAJ-AVZVGXBISA-N |
| XLogP | 3.95 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|