About N'-(3-acetylphenyl)-N'-hydroxybutanediamide
N'-(3-acetylphenyl)-N'-hydroxybutanediamide (PubChem CID 174524493) has the molecular formula C12H14N2O4
and a molecular weight of 250.25 g/mol. Its IUPAC name is N'-(3-acetylphenyl)-N'-hydroxybutanediamide.
Molecular Properties
| Compound Name | N'-(3-acetylphenyl)-N'-hydroxybutanediamide |
| PubChem CID | 174524493 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N'-(3-acetylphenyl)-N'-hydroxybutanediamide |
| SMILES | CC(=O)c1cccc(N(O)C(=O)CCC(N)=O)c1 |
| InChI | InChI=1S/C12H14N2O4/c1-8(15)9-3-2-4-10(7-9)14(18)12(17)6-5-11(13)16/h2-4,7,18H,5-6H2,1H3,(H2,13,16) |
| InChIKey | LAPSSZRQYPXORJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-acetylphenyl)-N'-hydroxybutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-acetylphenyl)-N'-hydroxybutanediamide?
The IUPAC name of N'-(3-acetylphenyl)-N'-hydroxybutanediamide (CID 174524493) is N'-(3-acetylphenyl)-N'-hydroxybutanediamide.
What is the SMILES notation for N'-(3-acetylphenyl)-N'-hydroxybutanediamide?
The canonical SMILES for N'-(3-acetylphenyl)-N'-hydroxybutanediamide is CC(=O)c1cccc(N(O)C(=O)CCC(N)=O)c1.
What is the InChIKey of N'-(3-acetylphenyl)-N'-hydroxybutanediamide?
The InChIKey is LAPSSZRQYPXORJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4/c1-8(15)9-3-2-4-10(7-9)14(18)12(17)6-5-11(13)16/h2-4,7,18H,5-6H2,1H3,(H2,13,16).
What are the key properties of N'-(3-acetylphenyl)-N'-hydroxybutanediamide?
N'-(3-acetylphenyl)-N'-hydroxybutanediamide has a molecular weight of 250.25 g/mol, XLogP of 0.88, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-acetylphenyl)-N'-hydroxybutanediamide is sourced from PubChem (CID 174524493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).