About sodium;2-O-amino 1-O-dodecyl oxalate;hydride
sodium;2-O-amino 1-O-dodecyl oxalate;hydride (PubChem CID 174526441) has the molecular formula C14H28NNaO4
and a molecular weight of 297.37 g/mol. Its IUPAC name is sodium;2-O-amino 1-O-dodecyl oxalate;hydride.
Molecular Properties
| Compound Name | sodium;2-O-amino 1-O-dodecyl oxalate;hydride |
| PubChem CID | 174526441 |
| Molecular Formula | C14H28NNaO4 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | sodium;2-O-amino 1-O-dodecyl oxalate;hydride |
| SMILES | CCCCCCCCCCCCOC(=O)C(=O)ON.[H-].[Na+] |
| InChI | InChI=1S/C14H27NO4.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-18-13(16)14(17)19-15;;/h2-12,15H2,1H3;;/q;+1;-1 |
| InChIKey | BKPLVWJZJCLYBE-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-O-amino 1-O-dodecyl oxalate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-O-amino 1-O-dodecyl oxalate;hydride?
The IUPAC name of sodium;2-O-amino 1-O-dodecyl oxalate;hydride (CID 174526441) is sodium;2-O-amino 1-O-dodecyl oxalate;hydride.
What is the SMILES notation for sodium;2-O-amino 1-O-dodecyl oxalate;hydride?
The canonical SMILES for sodium;2-O-amino 1-O-dodecyl oxalate;hydride is CCCCCCCCCCCCOC(=O)C(=O)ON.[H-].[Na+].
What is the InChIKey of sodium;2-O-amino 1-O-dodecyl oxalate;hydride?
The InChIKey is BKPLVWJZJCLYBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO4.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-18-13(16)14(17)19-15;;/h2-12,15H2,1H3;;/q;+1;-1.
What are the key properties of sodium;2-O-amino 1-O-dodecyl oxalate;hydride?
sodium;2-O-amino 1-O-dodecyl oxalate;hydride has a molecular weight of 297.37 g/mol, XLogP of -0.02, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-O-amino 1-O-dodecyl oxalate;hydride is sourced from PubChem (CID 174526441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).