C25H22O6 — CID 174526648
[3-(5-benzoyl-3,4-dihydroxy-2-methoxyphenyl)-2-ethylphenyl] prop-2-enoate (PubChem CID 174526648) has the molecular formula C25H22O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is [3-(5-benzoyl-3,4-dihydroxy-2-methoxyphenyl)-2-ethylphenyl] prop-2-enoate.
| Compound Name | [3-(5-benzoyl-3,4-dihydroxy-2-methoxyphenyl)-2-ethylphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174526648 |
| Molecular Formula | C25H22O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [3-(5-benzoyl-3,4-dihydroxy-2-methoxyphenyl)-2-ethylphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cccc(-c2cc(C(=O)c3ccccc3)c(O)c(O)c2OC)c1CC |
| InChI | InChI=1S/C25H22O6/c1-4-16-17(12-9-13-20(16)31-21(26)5-2)18-14-19(23(28)24(29)25(18)30-3)22(27)15-10-7-6-8-11-15/h5-14,28-29H,2,4H2,1,3H3 |
| InChIKey | LDISKJHGIDLZHQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|