About azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride
azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride (PubChem CID 174661584) has the molecular formula C18H22ClNO2
and a molecular weight of 319.83 g/mol. Its IUPAC name is azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride |
| PubChem CID | 174661584 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride |
| SMILES | C=CC(=O)Oc1ccc(-c2ccccc2)c(C)c1CC.Cl.N |
| InChI | InChI=1S/C18H18O2.ClH.H3N/c1-4-15-13(3)16(14-9-7-6-8-10-14)11-12-17(15)20-18(19)5-2;;/h5-12H,2,4H2,1,3H3;1H;1H3 |
| InChIKey | CWOLXINPLMHBNB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride?
The IUPAC name of azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride (CID 174661584) is azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride.
What is the SMILES notation for azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride?
The canonical SMILES for azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride is C=CC(=O)Oc1ccc(-c2ccccc2)c(C)c1CC.Cl.N.
What is the InChIKey of azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride?
The InChIKey is CWOLXINPLMHBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O2.ClH.H3N/c1-4-15-13(3)16(14-9-7-6-8-10-14)11-12-17(15)20-18(19)5-2;;/h5-12H,2,4H2,1,3H3;1H;1H3.
What are the key properties of azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride?
azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride has a molecular weight of 319.83 g/mol, XLogP of 4.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(2-ethyl-3-methyl-4-phenylphenyl) prop-2-enoate;hydrochloride is sourced from PubChem (CID 174661584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).