C13H16Br2O4 — CID 174526749
5-(2,2-dibromoethyl)-2,4-bis(methoxymethyl)benzoic acid (PubChem CID 174526749) has the molecular formula C13H16Br2O4 and a molecular weight of 396.08 g/mol. Its IUPAC name is 5-(2,2-dibromoethyl)-2,4-bis(methoxymethyl)benzoic acid.
| Compound Name | 5-(2,2-dibromoethyl)-2,4-bis(methoxymethyl)benzoic acid |
|---|---|
| PubChem CID | 174526749 |
| Molecular Formula | C13H16Br2O4 |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | 5-(2,2-dibromoethyl)-2,4-bis(methoxymethyl)benzoic acid |
| SMILES | COCc1cc(COC)c(C(=O)O)cc1CC(Br)Br |
| InChI | InChI=1S/C13H16Br2O4/c1-18-6-9-3-10(7-19-2)11(13(16)17)4-8(9)5-12(14)15/h3-4,12H,5-7H2,1-2H3,(H,16,17) |
| InChIKey | MVPFKOPYBHMSGG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|