C17H20F3N3O — CID 174526965
N,N-dipropyl-4-[3-(trifluoromethoxy)phenyl]pyrimidin-5-amine (PubChem CID 174526965) has the molecular formula C17H20F3N3O and a molecular weight of 339.36 g/mol. Its IUPAC name is N,N-dipropyl-4-[3-(trifluoromethoxy)phenyl]pyrimidin-5-amine.
| Compound Name | N,N-dipropyl-4-[3-(trifluoromethoxy)phenyl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 174526965 |
| Molecular Formula | C17H20F3N3O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N,N-dipropyl-4-[3-(trifluoromethoxy)phenyl]pyrimidin-5-amine |
| SMILES | CCCN(CCC)c1cncnc1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F3N3O/c1-3-8-23(9-4-2)15-11-21-12-22-16(15)13-6-5-7-14(10-13)24-17(18,19)20/h5-7,10-12H,3-4,8-9H2,1-2H3 |
| InChIKey | BOCVEMCECVLMDT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |