C17H23NO2 — CID 174528362
[3-[2-butyl-5-(hydroxyiminomethyl)cyclopenten-1-yl]phenyl]methanol (PubChem CID 174528362) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is [3-[2-butyl-5-(hydroxyiminomethyl)cyclopenten-1-yl]phenyl]methanol.
| Compound Name | [3-[2-butyl-5-(hydroxyiminomethyl)cyclopenten-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 174528362 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [3-[2-butyl-5-(hydroxyiminomethyl)cyclopenten-1-yl]phenyl]methanol |
| SMILES | CCCCC1=C(c2cccc(CO)c2)C(C=NO)CC1 |
| InChI | InChI=1S/C17H23NO2/c1-2-3-6-14-8-9-16(11-18-20)17(14)15-7-4-5-13(10-15)12-19/h4-5,7,10-11,16,19-20H,2-3,6,8-9,12H2,1H3 |
| InChIKey | DENYVUCOKPMKDF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|