C16H19NO2 — CID 91597941
3-butyl-2-[3-(nitrosomethyl)phenyl]cyclopent-2-en-1-one (PubChem CID 91597941) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-butyl-2-[3-(nitrosomethyl)phenyl]cyclopent-2-en-1-one.
| Compound Name | 3-butyl-2-[3-(nitrosomethyl)phenyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 91597941 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-butyl-2-[3-(nitrosomethyl)phenyl]cyclopent-2-en-1-one |
| SMILES | CCCCC1=C(c2cccc(CN=O)c2)C(=O)CC1 |
| InChI | InChI=1S/C16H19NO2/c1-2-3-6-13-8-9-15(18)16(13)14-7-4-5-12(10-14)11-17-19/h4-5,7,10H,2-3,6,8-9,11H2,1H3 |
| InChIKey | KQWGJWGYMRPQRJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |