C23H18N4O3 — CID 174528602
methyl 4-[2-[3-(5-carbamoyl-1,2,4-triazol-1-yl)phenyl]phenyl]benzoate (PubChem CID 174528602) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is methyl 4-[2-[3-(5-carbamoyl-1,2,4-triazol-1-yl)phenyl]phenyl]benzoate.
| Compound Name | methyl 4-[2-[3-(5-carbamoyl-1,2,4-triazol-1-yl)phenyl]phenyl]benzoate |
|---|---|
| PubChem CID | 174528602 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | methyl 4-[2-[3-(5-carbamoyl-1,2,4-triazol-1-yl)phenyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccccc2-c2cccc(-n3ncnc3C(N)=O)c2)cc1 |
| InChI | InChI=1S/C23H18N4O3/c1-30-23(29)16-11-9-15(10-12-16)19-7-2-3-8-20(19)17-5-4-6-18(13-17)27-22(21(24)28)25-14-26-27/h2-14H,1H3,(H2,24,28) |
| InChIKey | PGPBNYPEEFOFRD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |