C16H12BrN3O2 — CID 1364759
methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate (PubChem CID 1364759) has the molecular formula C16H12BrN3O2 and a molecular weight of 358.20 g/mol. Its IUPAC name is methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate.
| Compound Name | methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate |
|---|---|
| PubChem CID | 1364759 |
| Molecular Formula | C16H12BrN3O2 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2ncnc2-c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C16H12BrN3O2/c1-22-16(21)11-5-7-14(8-6-11)20-15(18-10-19-20)12-3-2-4-13(17)9-12/h2-10H,1H3 |
| InChIKey | AXYIGKRQJLNDFI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |