About methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate
methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate (PubChem CID 1364759) has the molecular formula C16H12BrN3O2
and a molecular weight of 358.20 g/mol. Its IUPAC name is methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate |
| PubChem CID | 1364759 |
| Molecular Formula | C16H12BrN3O2 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2ncnc2-c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C16H12BrN3O2/c1-22-16(21)11-5-7-14(8-6-11)20-15(18-10-19-20)12-3-2-4-13(17)9-12/h2-10H,1H3 |
| InChIKey | AXYIGKRQJLNDFI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate?
The IUPAC name of methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate (CID 1364759) is methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate.
What is the SMILES notation for methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate?
The canonical SMILES for methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate is COC(=O)c1ccc(-n2ncnc2-c2cccc(Br)c2)cc1.
What is the InChIKey of methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate?
The InChIKey is AXYIGKRQJLNDFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrN3O2/c1-22-16(21)11-5-7-14(8-6-11)20-15(18-10-19-20)12-3-2-4-13(17)9-12/h2-10H,1H3.
What are the key properties of methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate?
methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate has a molecular weight of 358.20 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[5-(3-bromophenyl)-1,2,4-triazol-1-yl]benzoate is sourced from PubChem (CID 1364759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).