C22H22N6O2 — CID 174530124
N-(diaminomethylidene)naphthalene-2-carboxamide;N-(diaminomethylidene)-3-phenylprop-2-enamide (PubChem CID 174530124) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-(diaminomethylidene)naphthalene-2-carboxamide;N-(diaminomethylidene)-3-phenylprop-2-enamide.
| Compound Name | N-(diaminomethylidene)naphthalene-2-carboxamide;N-(diaminomethylidene)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 174530124 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-(diaminomethylidene)naphthalene-2-carboxamide;N-(diaminomethylidene)-3-phenylprop-2-enamide |
| SMILES | NC(N)=NC(=O)C=Cc1ccccc1.NC(N)=NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H11N3O.C10H11N3O/c13-12(14)15-11(16)10-6-5-8-3-1-2-4-9(8)7-10;11-10(12)13-9(14)7-6-8-4-2-1-3-5-8/h1-7H,(H4,13,14,15,16);1-7H,(H4,11,12,13,14) |
| InChIKey | CFDUJYVYXIGMBT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|