C20H20Cl2N6O2 — CID 174544055
N-(diaminomethylidene)-3-(2,6-dichlorophenyl)prop-2-enamide;N-(diaminomethylidene)-3-phenylprop-2-enamide (PubChem CID 174544055) has the molecular formula C20H20Cl2N6O2 and a molecular weight of 447.33 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-(2,6-dichlorophenyl)prop-2-enamide;N-(diaminomethylidene)-3-phenylprop-2-enamide.
| Compound Name | N-(diaminomethylidene)-3-(2,6-dichlorophenyl)prop-2-enamide;N-(diaminomethylidene)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 174544055 |
| Molecular Formula | C20H20Cl2N6O2 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-(diaminomethylidene)-3-(2,6-dichlorophenyl)prop-2-enamide;N-(diaminomethylidene)-3-phenylprop-2-enamide |
| SMILES | NC(N)=NC(=O)C=Cc1c(Cl)cccc1Cl.NC(N)=NC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C10H9Cl2N3O.C10H11N3O/c11-7-2-1-3-8(12)6(7)4-5-9(16)15-10(13)14;11-10(12)13-9(14)7-6-8-4-2-1-3-5-8/h1-5H,(H4,13,14,15,16);1-7H,(H4,11,12,13,14) |
| InChIKey | MVISFOGIMSTTFF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|