C13H29N3 — CID 174530275
azane;2,5-dipentyl-1,5-dihydropyrazole (PubChem CID 174530275) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is azane;2,5-dipentyl-1,5-dihydropyrazole.
| Compound Name | azane;2,5-dipentyl-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 174530275 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | azane;2,5-dipentyl-1,5-dihydropyrazole |
| SMILES | CCCCCC1C=CN(CCCCC)N1.N |
| InChI | InChI=1S/C13H26N2.H3N/c1-3-5-7-9-13-10-12-15(14-13)11-8-6-4-2;/h10,12-14H,3-9,11H2,1-2H3;1H3 |
| InChIKey | ZZXYPZPBZOSISB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|