About 1,3-dipentyl-2H-triazole
1,3-dipentyl-2H-triazole (PubChem CID 67465157) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is 1,3-dipentyl-2H-triazole.
Molecular Properties
| Compound Name | 1,3-dipentyl-2H-triazole |
| PubChem CID | 67465157 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 1,3-dipentyl-2H-triazole |
| SMILES | CCCCCN1C=CN(CCCCC)N1 |
| InChI | InChI=1S/C12H25N3/c1-3-5-7-9-14-11-12-15(13-14)10-8-6-4-2/h11-13H,3-10H2,1-2H3 |
| InChIKey | OCLBFOXURKHALU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dipentyl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dipentyl-2H-triazole?
The IUPAC name of 1,3-dipentyl-2H-triazole (CID 67465157) is 1,3-dipentyl-2H-triazole.
What is the SMILES notation for 1,3-dipentyl-2H-triazole?
The canonical SMILES for 1,3-dipentyl-2H-triazole is CCCCCN1C=CN(CCCCC)N1.
What is the InChIKey of 1,3-dipentyl-2H-triazole?
The InChIKey is OCLBFOXURKHALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3/c1-3-5-7-9-14-11-12-15(13-14)10-8-6-4-2/h11-13H,3-10H2,1-2H3.
What are the key properties of 1,3-dipentyl-2H-triazole?
1,3-dipentyl-2H-triazole has a molecular weight of 211.35 g/mol, XLogP of 2.88, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dipentyl-2H-triazole is sourced from PubChem (CID 67465157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).