C15H18O2 — CID 174532195
5,7-dipropylchromen-2-one (PubChem CID 174532195) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 5,7-dipropylchromen-2-one.
| Compound Name | 5,7-dipropylchromen-2-one |
|---|---|
| PubChem CID | 174532195 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 5,7-dipropylchromen-2-one |
| SMILES | CCCc1cc(CCC)c2ccc(=O)oc2c1 |
| InChI | InChI=1S/C15H18O2/c1-3-5-11-9-12(6-4-2)13-7-8-15(16)17-14(13)10-11/h7-10H,3-6H2,1-2H3 |
| InChIKey | WCNGTSPQDHCOHL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|